C29H25NO6 — CID 134548225
[3-cyano-4-[2-(4-prop-2-enoyloxyphenyl)ethyl]phenyl] 4-(1-hydroxy-2-methylprop-2-enoxy)benzoate (PubChem CID 134548225) has the molecular formula C29H25NO6 and a molecular weight of 483.52 g/mol. Its IUPAC name is [3-cyano-4-[2-(4-prop-2-enoyloxyphenyl)ethyl]phenyl] 4-(1-hydroxy-2-methylprop-2-enoxy)benzoate.
| Compound Name | [3-cyano-4-[2-(4-prop-2-enoyloxyphenyl)ethyl]phenyl] 4-(1-hydroxy-2-methylprop-2-enoxy)benzoate |
|---|---|
| PubChem CID | 134548225 |
| Molecular Formula | C29H25NO6 |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | [3-cyano-4-[2-(4-prop-2-enoyloxyphenyl)ethyl]phenyl] 4-(1-hydroxy-2-methylprop-2-enoxy)benzoate |
| SMILES | C=CC(=O)Oc1ccc(CCc2ccc(OC(=O)c3ccc(OC(O)C(=C)C)cc3)cc2C#N)cc1 |
| InChI | InChI=1S/C29H25NO6/c1-4-27(31)34-24-12-6-20(7-13-24)5-8-21-9-16-26(17-23(21)18-30)36-29(33)22-10-14-25(15-11-22)35-28(32)19(2)3/h4,6-7,9-17,28,32H,1-2,5,8H2,3H3 |
| InChIKey | MHGNCISYZCCKHW-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 105.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|