C23H22O4 — CID 91062192
3-[2-[3-[2-(4-methylphenyl)ethyl]phenyl]ethenyl]benzene-1,2,4,5-tetrol (PubChem CID 91062192) has the molecular formula C23H22O4 and a molecular weight of 362.43 g/mol. Its IUPAC name is 3-[2-[3-[2-(4-methylphenyl)ethyl]phenyl]ethenyl]benzene-1,2,4,5-tetrol.
| Compound Name | 3-[2-[3-[2-(4-methylphenyl)ethyl]phenyl]ethenyl]benzene-1,2,4,5-tetrol |
|---|---|
| PubChem CID | 91062192 |
| Molecular Formula | C23H22O4 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 3-[2-[3-[2-(4-methylphenyl)ethyl]phenyl]ethenyl]benzene-1,2,4,5-tetrol |
| SMILES | Cc1ccc(CCc2cccc(C=Cc3c(O)c(O)cc(O)c3O)c2)cc1 |
| InChI | InChI=1S/C23H22O4/c1-15-5-7-16(8-6-15)9-10-17-3-2-4-18(13-17)11-12-19-22(26)20(24)14-21(25)23(19)27/h2-8,11-14,24-27H,9-10H2,1H3 |
| InChIKey | DHOAYDCFZHTBCU-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|