C17H19ClN4O — CID 137483189
4-[7-chloro-2-[(2E,4Z)-hexa-2,4-dien-3-yl]pyrido[3,2-d]pyrimidin-4-yl]morpholine (PubChem CID 137483189) has the molecular formula C17H19ClN4O and a molecular weight of 330.82 g/mol. Its IUPAC name is 4-[7-chloro-2-[(2E,4Z)-hexa-2,4-dien-3-yl]pyrido[3,2-d]pyrimidin-4-yl]morpholine.
| Compound Name | 4-[7-chloro-2-[(2E,4Z)-hexa-2,4-dien-3-yl]pyrido[3,2-d]pyrimidin-4-yl]morpholine |
|---|---|
| PubChem CID | 137483189 |
| Molecular Formula | C17H19ClN4O |
| Molecular Weight | 330.82 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 4-[7-chloro-2-[(2E,4Z)-hexa-2,4-dien-3-yl]pyrido[3,2-d]pyrimidin-4-yl]morpholine |
| SMILES | C/C=C\C(=C/C)c1nc(N2CCOCC2)c2ncc(Cl)cc2n1 |
| InChI | InChI=1S/C17H19ClN4O/c1-3-5-12(4-2)16-20-14-10-13(18)11-19-15(14)17(21-16)22-6-8-23-9-7-22/h3-5,10-11H,6-9H2,1-2H3/b5-3-,12-4+ |
| InChIKey | ALCCDQZUJVMPMG-BVEFSZSYSA-N |
| XLogP | 3.49 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.82 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|