C20H23N5O — CID 87621530
3-[4-morpholin-4-yl-2-[(3Z)-penta-1,3-dien-2-yl]pyrido[3,2-d]pyrimidin-7-yl]but-3-en-2-imine (PubChem CID 87621530) has the molecular formula C20H23N5O and a molecular weight of 349.44 g/mol. Its IUPAC name is 3-[4-morpholin-4-yl-2-[(3Z)-penta-1,3-dien-2-yl]pyrido[3,2-d]pyrimidin-7-yl]but-3-en-2-imine.
| Compound Name | 3-[4-morpholin-4-yl-2-[(3Z)-penta-1,3-dien-2-yl]pyrido[3,2-d]pyrimidin-7-yl]but-3-en-2-imine |
|---|---|
| PubChem CID | 87621530 |
| Molecular Formula | C20H23N5O |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | 3-[4-morpholin-4-yl-2-[(3Z)-penta-1,3-dien-2-yl]pyrido[3,2-d]pyrimidin-7-yl]but-3-en-2-imine |
| SMILES | [H]/N=C(\C)C(=C)c1cnc2c(N3CCOCC3)nc(C(=C)/C=C\C)nc2c1 |
| InChI | InChI=1S/C20H23N5O/c1-5-6-13(2)19-23-17-11-16(14(3)15(4)21)12-22-18(17)20(24-19)25-7-9-26-10-8-25/h5-6,11-12,21H,2-3,7-10H2,1,4H3/b6-5-,21-15+ |
| InChIKey | GCKUBMUTOVDVFF-USVLAAQWSA-N |
| XLogP | 3.50 |
| TPSA | 74.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|