C21H24N4O — CID 87621333
N-[(E)-2-[4-morpholin-4-yl-2-[(3Z)-penta-1,3-dien-2-yl]quinazolin-7-yl]prop-1-enyl]methanimine (PubChem CID 87621333) has the molecular formula C21H24N4O and a molecular weight of 348.45 g/mol. Its IUPAC name is N-[(E)-2-[4-morpholin-4-yl-2-[(3Z)-penta-1,3-dien-2-yl]quinazolin-7-yl]prop-1-enyl]methanimine.
| Compound Name | N-[(E)-2-[4-morpholin-4-yl-2-[(3Z)-penta-1,3-dien-2-yl]quinazolin-7-yl]prop-1-enyl]methanimine |
|---|---|
| PubChem CID | 87621333 |
| Molecular Formula | C21H24N4O |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | N-[(E)-2-[4-morpholin-4-yl-2-[(3Z)-penta-1,3-dien-2-yl]quinazolin-7-yl]prop-1-enyl]methanimine |
| SMILES | C=N/C=C(\C)c1ccc2c(N3CCOCC3)nc(C(=C)/C=C\C)nc2c1 |
| InChI | InChI=1S/C21H24N4O/c1-5-6-15(2)20-23-19-13-17(16(3)14-22-4)7-8-18(19)21(24-20)25-9-11-26-12-10-25/h5-8,13-14H,2,4,9-12H2,1,3H3/b6-5-,16-14+ |
| InChIKey | GIBZYZBLGPQEIK-LKLRBXRGSA-N |
| XLogP | 4.12 |
| TPSA | 50.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|