C21H23FN4O — CID 87621347
N-[(E)-2-[6-fluoro-4-morpholin-4-yl-2-[(3Z)-penta-1,3-dien-2-yl]quinazolin-7-yl]prop-1-enyl]methanimine (PubChem CID 87621347) has the molecular formula C21H23FN4O and a molecular weight of 366.44 g/mol. Its IUPAC name is N-[(E)-2-[6-fluoro-4-morpholin-4-yl-2-[(3Z)-penta-1,3-dien-2-yl]quinazolin-7-yl]prop-1-enyl]methanimine.
| Compound Name | N-[(E)-2-[6-fluoro-4-morpholin-4-yl-2-[(3Z)-penta-1,3-dien-2-yl]quinazolin-7-yl]prop-1-enyl]methanimine |
|---|---|
| PubChem CID | 87621347 |
| Molecular Formula | C21H23FN4O |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | N-[(E)-2-[6-fluoro-4-morpholin-4-yl-2-[(3Z)-penta-1,3-dien-2-yl]quinazolin-7-yl]prop-1-enyl]methanimine |
| SMILES | C=N/C=C(\C)c1cc2nc(C(=C)/C=C\C)nc(N3CCOCC3)c2cc1F |
| InChI | InChI=1S/C21H23FN4O/c1-5-6-14(2)20-24-19-12-16(15(3)13-23-4)18(22)11-17(19)21(25-20)26-7-9-27-10-8-26/h5-6,11-13H,2,4,7-10H2,1,3H3/b6-5-,15-13+ |
| InChIKey | KJZUHXMXBIYXHA-ZEIZGHEPSA-N |
| XLogP | 4.26 |
| TPSA | 50.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|