C15H24FNO5 — CID 137487130
7-O-tert-butyl 8-O-methyl (5aS)-4-fluoro-2,3,4,5,5a,6,8,8a-octahydrooxepino[2,3-c]pyrrole-7,8-dicarboxylate (PubChem CID 137487130) has the molecular formula C15H24FNO5 and a molecular weight of 317.36 g/mol. Its IUPAC name is 7-O-tert-butyl 8-O-methyl (5aS)-4-fluoro-2,3,4,5,5a,6,8,8a-octahydrooxepino[2,3-c]pyrrole-7,8-dicarboxylate.
| Compound Name | 7-O-tert-butyl 8-O-methyl (5aS)-4-fluoro-2,3,4,5,5a,6,8,8a-octahydrooxepino[2,3-c]pyrrole-7,8-dicarboxylate |
|---|---|
| PubChem CID | 137487130 |
| Molecular Formula | C15H24FNO5 |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 7-O-tert-butyl 8-O-methyl (5aS)-4-fluoro-2,3,4,5,5a,6,8,8a-octahydrooxepino[2,3-c]pyrrole-7,8-dicarboxylate |
| SMILES | COC(=O)C1C2OCCC(F)C[C@H]2CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H24FNO5/c1-15(2,3)22-14(19)17-8-9-7-10(16)5-6-21-12(9)11(17)13(18)20-4/h9-12H,5-8H2,1-4H3/t9-,10?,11?,12?/m0/s1 |
| InChIKey | ZUXWCSFHGXJWGY-ZLMIFYAYSA-N |
| XLogP | 1.91 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |