C16H27NO5 — CID 166855846
7-O-tert-butyl 8-O-methyl (4S,5aS,8S,8aR)-4-methyl-2,3,4,5,5a,6,8,8a-octahydrooxepino[2,3-c]pyrrole-7,8-dicarboxylate (PubChem CID 166855846) has the molecular formula C16H27NO5 and a molecular weight of 313.39 g/mol. Its IUPAC name is 7-O-tert-butyl 8-O-methyl (4S,5aS,8S,8aR)-4-methyl-2,3,4,5,5a,6,8,8a-octahydrooxepino[2,3-c]pyrrole-7,8-dicarboxylate.
| Compound Name | 7-O-tert-butyl 8-O-methyl (4S,5aS,8S,8aR)-4-methyl-2,3,4,5,5a,6,8,8a-octahydrooxepino[2,3-c]pyrrole-7,8-dicarboxylate |
|---|---|
| PubChem CID | 166855846 |
| Molecular Formula | C16H27NO5 |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | 7-O-tert-butyl 8-O-methyl (4S,5aS,8S,8aR)-4-methyl-2,3,4,5,5a,6,8,8a-octahydrooxepino[2,3-c]pyrrole-7,8-dicarboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H]2OCC[C@@H](C)C[C@H]2CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H27NO5/c1-10-6-7-21-13-11(8-10)9-17(12(13)14(18)20-5)15(19)22-16(2,3)4/h10-13H,6-9H2,1-5H3/t10-,11+,12+,13-/m1/s1 |
| InChIKey | LBSFUMOYJLGYPF-MROQNXINSA-N |
| XLogP | 2.21 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |