C18H30N4O5 — CID 168819895
tert-butyl (4S,5aS,8S,8aR)-4-(3-azidopropyl)-8-(2-hydroxyacetyl)-2,3,4,5,5a,6,8,8a-octahydrooxepino[2,3-c]pyrrole-7-carboxylate (PubChem CID 168819895) has the molecular formula C18H30N4O5 and a molecular weight of 382.46 g/mol. Its IUPAC name is tert-butyl (4S,5aS,8S,8aR)-4-(3-azidopropyl)-8-(2-hydroxyacetyl)-2,3,4,5,5a,6,8,8a-octahydrooxepino[2,3-c]pyrrole-7-carboxylate.
| Compound Name | tert-butyl (4S,5aS,8S,8aR)-4-(3-azidopropyl)-8-(2-hydroxyacetyl)-2,3,4,5,5a,6,8,8a-octahydrooxepino[2,3-c]pyrrole-7-carboxylate |
|---|---|
| PubChem CID | 168819895 |
| Molecular Formula | C18H30N4O5 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | tert-butyl (4S,5aS,8S,8aR)-4-(3-azidopropyl)-8-(2-hydroxyacetyl)-2,3,4,5,5a,6,8,8a-octahydrooxepino[2,3-c]pyrrole-7-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2C[C@H](CCCN=[N+]=[N-])CCO[C@H]2[C@H]1C(=O)CO |
| InChI | InChI=1S/C18H30N4O5/c1-18(2,3)27-17(25)22-10-13-9-12(5-4-7-20-21-19)6-8-26-16(13)15(22)14(24)11-23/h12-13,15-16,23H,4-11H2,1-3H3/t12-,13+,15-,16-/m1/s1 |
| InChIKey | IOBIKGAHRDVOHP-OCVGTWLNSA-N |
| XLogP | 2.67 |
| TPSA | 124.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|