C15H26N4O4 — CID 54242216
1-O-tert-butyl 2-O-ethyl (2S)-4-(3-azidopropyl)pyrrolidine-1,2-dicarboxylate (PubChem CID 54242216) has the molecular formula C15H26N4O4 and a molecular weight of 326.40 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-ethyl (2S)-4-(3-azidopropyl)pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-ethyl (2S)-4-(3-azidopropyl)pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 54242216 |
| Molecular Formula | C15H26N4O4 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | 1-O-tert-butyl 2-O-ethyl (2S)-4-(3-azidopropyl)pyrrolidine-1,2-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1CC(CCCN=[N+]=[N-])CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H26N4O4/c1-5-22-13(20)12-9-11(7-6-8-17-18-16)10-19(12)14(21)23-15(2,3)4/h11-12H,5-10H2,1-4H3/t11?,12-/m0/s1 |
| InChIKey | QQUGXWDOMKVJGG-KIYNQFGBSA-N |
| XLogP | 3.27 |
| TPSA | 104.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|