C18H28N2O7 — CID 137487188
7-O-tert-butyl 8-O-methyl 4-O-prop-2-enyl (5aS)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepine-4,7,8-tricarboxylate (PubChem CID 137487188) has the molecular formula C18H28N2O7 and a molecular weight of 384.43 g/mol. Its IUPAC name is 7-O-tert-butyl 8-O-methyl 4-O-prop-2-enyl (5aS)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepine-4,7,8-tricarboxylate.
| Compound Name | 7-O-tert-butyl 8-O-methyl 4-O-prop-2-enyl (5aS)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepine-4,7,8-tricarboxylate |
|---|---|
| PubChem CID | 137487188 |
| Molecular Formula | C18H28N2O7 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | 7-O-tert-butyl 8-O-methyl 4-O-prop-2-enyl (5aS)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepine-4,7,8-tricarboxylate |
| SMILES | C=CCOC(=O)N1CCOC2C(C(=O)OC)N(C(=O)OC(C)(C)C)C[C@@H]2C1 |
| InChI | InChI=1S/C18H28N2O7/c1-6-8-26-16(22)19-7-9-25-14-12(10-19)11-20(13(14)15(21)24-5)17(23)27-18(2,3)4/h6,12-14H,1,7-11H2,2-5H3/t12-,13?,14?/m0/s1 |
| InChIKey | IVBQHPBSNMGEJM-HSBZDZAISA-N |
| XLogP | 1.42 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|