C17H25NO5 — CID 155631097
tert-butyl (5aS,8S,8aR)-4-ethenyl-8-(2-hydroxyacetyl)-2,5,5a,6,8,8a-hexahydrooxepino[2,3-c]pyrrole-7-carboxylate (PubChem CID 155631097) has the molecular formula C17H25NO5 and a molecular weight of 323.39 g/mol. Its IUPAC name is tert-butyl (5aS,8S,8aR)-4-ethenyl-8-(2-hydroxyacetyl)-2,5,5a,6,8,8a-hexahydrooxepino[2,3-c]pyrrole-7-carboxylate.
| Compound Name | tert-butyl (5aS,8S,8aR)-4-ethenyl-8-(2-hydroxyacetyl)-2,5,5a,6,8,8a-hexahydrooxepino[2,3-c]pyrrole-7-carboxylate |
|---|---|
| PubChem CID | 155631097 |
| Molecular Formula | C17H25NO5 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | tert-butyl (5aS,8S,8aR)-4-ethenyl-8-(2-hydroxyacetyl)-2,5,5a,6,8,8a-hexahydrooxepino[2,3-c]pyrrole-7-carboxylate |
| SMILES | C=CC1=CCO[C@@H]2[C@@H](C1)CN(C(=O)OC(C)(C)C)[C@@H]2C(=O)CO |
| InChI | InChI=1S/C17H25NO5/c1-5-11-6-7-22-15-12(8-11)9-18(14(15)13(20)10-19)16(21)23-17(2,3)4/h5-6,12,14-15,19H,1,7-10H2,2-4H3/t12-,14+,15+/m0/s1 |
| InChIKey | JIMRHYKUAPUPQU-NWANDNLSSA-N |
| XLogP | 1.68 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |