C10H13BrN2 — CID 137487756
(2E,3Z,5E)-7-bromo-2-ethylidene-N-methylidenehepta-3,5-dienimidamide (PubChem CID 137487756) has the molecular formula C10H13BrN2 and a molecular weight of 241.13 g/mol. Its IUPAC name is (2E,3Z,5E)-7-bromo-2-ethylidene-N-methylidenehepta-3,5-dienimidamide.
| Compound Name | (2E,3Z,5E)-7-bromo-2-ethylidene-N-methylidenehepta-3,5-dienimidamide |
|---|---|
| PubChem CID | 137487756 |
| Molecular Formula | C10H13BrN2 |
| Molecular Weight | 241.13 g/mol |
| Exact Mass | 240.03 |
| IUPAC Name | (2E,3Z,5E)-7-bromo-2-ethylidene-N-methylidenehepta-3,5-dienimidamide |
| SMILES | [H]/N=C(N=C)/C(/C=C\C=C\CBr)=C/C |
| InChI | InChI=1S/C10H13BrN2/c1-3-9(10(12)13-2)7-5-4-6-8-11/h3-7,12H,2,8H2,1H3/b6-4+,7-5-,9-3+,12-10- |
| InChIKey | RVGIJPAHBOKZHF-UCIJSIBHSA-N |
| XLogP | 3.12 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.13 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|