C17H19N7O4S — CID 137499982
ethyl 2-[[4-[2-[(5-methylpyrazin-2-yl)methyl]tetrazol-5-yl]phenyl]sulfonylamino]acetate (PubChem CID 137499982) has the molecular formula C17H19N7O4S and a molecular weight of 417.45 g/mol. Its IUPAC name is ethyl 2-[[4-[2-[(5-methylpyrazin-2-yl)methyl]tetrazol-5-yl]phenyl]sulfonylamino]acetate.
| Compound Name | ethyl 2-[[4-[2-[(5-methylpyrazin-2-yl)methyl]tetrazol-5-yl]phenyl]sulfonylamino]acetate |
|---|---|
| PubChem CID | 137499982 |
| Molecular Formula | C17H19N7O4S |
| Molecular Weight | 417.45 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | ethyl 2-[[4-[2-[(5-methylpyrazin-2-yl)methyl]tetrazol-5-yl]phenyl]sulfonylamino]acetate |
| SMILES | CCOC(=O)CNS(=O)(=O)c1ccc(-c2nnn(Cc3cnc(C)cn3)n2)cc1 |
| InChI | InChI=1S/C17H19N7O4S/c1-3-28-16(25)10-20-29(26,27)15-6-4-13(5-7-15)17-21-23-24(22-17)11-14-9-18-12(2)8-19-14/h4-9,20H,3,10-11H2,1-2H3 |
| InChIKey | HTARIDKOPHRTGX-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 141.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.45 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |