C15H22N8O3S — CID 156509941
2-[[4-[amino-[2-amino-2-[(5-methylpyrazin-2-yl)methyl]hydrazinyl]methyl]phenyl]sulfonylamino]acetamide (PubChem CID 156509941) has the molecular formula C15H22N8O3S and a molecular weight of 394.46 g/mol. Its IUPAC name is 2-[[4-[amino-[2-amino-2-[(5-methylpyrazin-2-yl)methyl]hydrazinyl]methyl]phenyl]sulfonylamino]acetamide.
| Compound Name | 2-[[4-[amino-[2-amino-2-[(5-methylpyrazin-2-yl)methyl]hydrazinyl]methyl]phenyl]sulfonylamino]acetamide |
|---|---|
| PubChem CID | 156509941 |
| Molecular Formula | C15H22N8O3S |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 2-[[4-[amino-[2-amino-2-[(5-methylpyrazin-2-yl)methyl]hydrazinyl]methyl]phenyl]sulfonylamino]acetamide |
| SMILES | Cc1cnc(CN(N)NC(N)c2ccc(S(=O)(=O)NCC(N)=O)cc2)cn1 |
| InChI | InChI=1S/C15H22N8O3S/c1-10-6-20-12(7-19-10)9-23(18)22-15(17)11-2-4-13(5-3-11)27(25,26)21-8-14(16)24/h2-7,15,21-22H,8-9,17-18H2,1H3,(H2,16,24) |
| InChIKey | DKDUVMYZPZUCHZ-UHFFFAOYSA-N |
| XLogP | -1.61 |
| TPSA | 182.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|