C14H18Cl2N2O4S — CID 138003697
2-(3,4-dichlorophenyl)-2-(4-methylsulfonyl-1,4-diazepan-1-yl)acetic acid (PubChem CID 138003697) has the molecular formula C14H18Cl2N2O4S and a molecular weight of 381.28 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-2-(4-methylsulfonyl-1,4-diazepan-1-yl)acetic acid.
| Compound Name | 2-(3,4-dichlorophenyl)-2-(4-methylsulfonyl-1,4-diazepan-1-yl)acetic acid |
|---|---|
| PubChem CID | 138003697 |
| Molecular Formula | C14H18Cl2N2O4S |
| Molecular Weight | 381.28 g/mol |
| Exact Mass | 380.04 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-2-(4-methylsulfonyl-1,4-diazepan-1-yl)acetic acid |
| SMILES | CS(=O)(=O)N1CCCN(C(C(=O)O)c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C14H18Cl2N2O4S/c1-23(21,22)18-6-2-5-17(7-8-18)13(14(19)20)10-3-4-11(15)12(16)9-10/h3-4,9,13H,2,5-8H2,1H3,(H,19,20) |
| InChIKey | WFMGLYUIHCLKJN-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.28 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |