C13H24N2O3 — CID 138014357
N-(3,3-dimethoxycyclobutyl)-3-ethylpyrrolidine-1-carboxamide (PubChem CID 138014357) has the molecular formula C13H24N2O3 and a molecular weight of 256.35 g/mol. Its IUPAC name is N-(3,3-dimethoxycyclobutyl)-3-ethylpyrrolidine-1-carboxamide.
| Compound Name | N-(3,3-dimethoxycyclobutyl)-3-ethylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 138014357 |
| Molecular Formula | C13H24N2O3 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | N-(3,3-dimethoxycyclobutyl)-3-ethylpyrrolidine-1-carboxamide |
| SMILES | CCC1CCN(C(=O)NC2CC(OC)(OC)C2)C1 |
| InChI | InChI=1S/C13H24N2O3/c1-4-10-5-6-15(9-10)12(16)14-11-7-13(8-11,17-2)18-3/h10-11H,4-9H2,1-3H3,(H,14,16) |
| InChIKey | VUNGOEKZJUROHD-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|