C19H25N3O3 — CID 138017857
(3aS,7aS)-7a-N-methyl-2-N-(2-phenylprop-2-enyl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-2,7a-dicarboxamide (PubChem CID 138017857) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is (3aS,7aS)-7a-N-methyl-2-N-(2-phenylprop-2-enyl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-2,7a-dicarboxamide.
| Compound Name | (3aS,7aS)-7a-N-methyl-2-N-(2-phenylprop-2-enyl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-2,7a-dicarboxamide |
|---|---|
| PubChem CID | 138017857 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | (3aS,7aS)-7a-N-methyl-2-N-(2-phenylprop-2-enyl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-2,7a-dicarboxamide |
| SMILES | C=C(CNC(=O)N1C[C@H]2COCC[C@@]2(C(=O)NC)C1)c1ccccc1 |
| InChI | InChI=1S/C19H25N3O3/c1-14(15-6-4-3-5-7-15)10-21-18(24)22-11-16-12-25-9-8-19(16,13-22)17(23)20-2/h3-7,16H,1,8-13H2,2H3,(H,20,23)(H,21,24)/t16-,19+/m0/s1 |
| InChIKey | XIXWSXFHFXEMJK-QFBILLFUSA-N |
| XLogP | 1.49 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |