C16H27N3O4 — CID 138049754
(3aR,7aR)-2-N-[(1R,2S)-2-ethoxy-2-methylcyclopropyl]-7a-N-methyl-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-2,7a-dicarboxamide (PubChem CID 138049754) has the molecular formula C16H27N3O4 and a molecular weight of 325.41 g/mol. Its IUPAC name is (3aR,7aR)-2-N-[(1R,2S)-2-ethoxy-2-methylcyclopropyl]-7a-N-methyl-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-2,7a-dicarboxamide.
| Compound Name | (3aR,7aR)-2-N-[(1R,2S)-2-ethoxy-2-methylcyclopropyl]-7a-N-methyl-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-2,7a-dicarboxamide |
|---|---|
| PubChem CID | 138049754 |
| Molecular Formula | C16H27N3O4 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | (3aR,7aR)-2-N-[(1R,2S)-2-ethoxy-2-methylcyclopropyl]-7a-N-methyl-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-2,7a-dicarboxamide |
| SMILES | CCO[C@@]1(C)C[C@H]1NC(=O)N1C[C@@H]2COCC[C@]2(C(=O)NC)C1 |
| InChI | InChI=1S/C16H27N3O4/c1-4-23-15(2)7-12(15)18-14(21)19-8-11-9-22-6-5-16(11,10-19)13(20)17-3/h11-12H,4-10H2,1-3H3,(H,17,20)(H,18,21)/t11-,12-,15+,16+/m1/s1 |
| InChIKey | FSUYWTNBDCXQEQ-MPTQWLOMSA-N |
| XLogP | 0.35 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |