C17H25N5O3 — CID 138017853
(3aS,7aS)-7a-N-methyl-2-N-(4,5,6,7-tetrahydro-1H-indazol-5-yl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-2,7a-dicarboxamide (PubChem CID 138017853) has the molecular formula C17H25N5O3 and a molecular weight of 347.42 g/mol. Its IUPAC name is (3aS,7aS)-7a-N-methyl-2-N-(4,5,6,7-tetrahydro-1H-indazol-5-yl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-2,7a-dicarboxamide.
| Compound Name | (3aS,7aS)-7a-N-methyl-2-N-(4,5,6,7-tetrahydro-1H-indazol-5-yl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-2,7a-dicarboxamide |
|---|---|
| PubChem CID | 138017853 |
| Molecular Formula | C17H25N5O3 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | (3aS,7aS)-7a-N-methyl-2-N-(4,5,6,7-tetrahydro-1H-indazol-5-yl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-2,7a-dicarboxamide |
| SMILES | CNC(=O)[C@@]12CCOC[C@@H]1CN(C(=O)NC1CCc3[nH]ncc3C1)C2 |
| InChI | InChI=1S/C17H25N5O3/c1-18-15(23)17-4-5-25-9-12(17)8-22(10-17)16(24)20-13-2-3-14-11(6-13)7-19-21-14/h7,12-13H,2-6,8-10H2,1H3,(H,18,23)(H,19,21)(H,20,24)/t12-,13?,17+/m0/s1 |
| InChIKey | VIPNYORIJHKFTK-GFMNRZNCSA-N |
| XLogP | 0.06 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |