C19H29N5O — CID 124736798
4-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-N-[(5S)-4,5,6,7-tetrahydro-1H-indazol-5-yl]piperazine-1-carboxamide (PubChem CID 124736798) has the molecular formula C19H29N5O and a molecular weight of 343.48 g/mol. Its IUPAC name is 4-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-N-[(5S)-4,5,6,7-tetrahydro-1H-indazol-5-yl]piperazine-1-carboxamide.
| Compound Name | 4-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-N-[(5S)-4,5,6,7-tetrahydro-1H-indazol-5-yl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 124736798 |
| Molecular Formula | C19H29N5O |
| Molecular Weight | 343.48 g/mol |
| Exact Mass | 343.24 |
| IUPAC Name | 4-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-N-[(5S)-4,5,6,7-tetrahydro-1H-indazol-5-yl]piperazine-1-carboxamide |
| SMILES | O=C(N[C@H]1CCc2[nH]ncc2C1)N1CCN([C@@H]2C[C@H]3CC[C@H]2C3)CC1 |
| InChI | InChI=1S/C19H29N5O/c25-19(21-16-3-4-17-15(11-16)12-20-22-17)24-7-5-23(6-8-24)18-10-13-1-2-14(18)9-13/h12-14,16,18H,1-11H2,(H,20,22)(H,21,25)/t13-,14-,16-,18+/m0/s1 |
| InChIKey | PDICHPPMZXTMIF-ILXVDBEPSA-N |
| XLogP | 1.78 |
| TPSA | 64.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.48 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |