C28H32N2O2 — CID 166207880
1-N,4-N-bis(2-phenylprop-2-enyl)bicyclo[2.2.2]octane-1,4-dicarboxamide (PubChem CID 166207880) has the molecular formula C28H32N2O2 and a molecular weight of 428.58 g/mol. Its IUPAC name is 1-N,4-N-bis(2-phenylprop-2-enyl)bicyclo[2.2.2]octane-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis(2-phenylprop-2-enyl)bicyclo[2.2.2]octane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 166207880 |
| Molecular Formula | C28H32N2O2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | 1-N,4-N-bis(2-phenylprop-2-enyl)bicyclo[2.2.2]octane-1,4-dicarboxamide |
| SMILES | C=C(CNC(=O)C12CCC(C(=O)NCC(=C)c3ccccc3)(CC1)CC2)c1ccccc1 |
| InChI | InChI=1S/C28H32N2O2/c1-21(23-9-5-3-6-10-23)19-29-25(31)27-13-16-28(17-14-27,18-15-27)26(32)30-20-22(2)24-11-7-4-8-12-24/h3-12H,1-2,13-20H2,(H,29,31)(H,30,32) |
| InChIKey | VQIIYYHCGNPEAG-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |