C10H16N2O4S — CID 138018726
N-(tert-butylsulfamoyl)-3-methylfuran-2-carboxamide (PubChem CID 138018726) has the molecular formula C10H16N2O4S and a molecular weight of 260.31 g/mol. Its IUPAC name is N-(tert-butylsulfamoyl)-3-methylfuran-2-carboxamide.
| Compound Name | N-(tert-butylsulfamoyl)-3-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 138018726 |
| Molecular Formula | C10H16N2O4S |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | N-(tert-butylsulfamoyl)-3-methylfuran-2-carboxamide |
| SMILES | Cc1ccoc1C(=O)NS(=O)(=O)NC(C)(C)C |
| InChI | InChI=1S/C10H16N2O4S/c1-7-5-6-16-8(7)9(13)11-17(14,15)12-10(2,3)4/h5-6,12H,1-4H3,(H,11,13) |
| InChIKey | UHALURWUVXJHQF-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |