C12H14F3N3O3S — CID 138022307
[(4aS,7aS)-1,1-dioxo-4a-(trifluoromethyl)-2,3,4,5,7,7a-hexahydrothiopyrano[2,3-c]pyrrol-6-yl]-(1H-pyrazol-5-yl)methanone (PubChem CID 138022307) has the molecular formula C12H14F3N3O3S and a molecular weight of 337.32 g/mol. Its IUPAC name is [(4aS,7aS)-1,1-dioxo-4a-(trifluoromethyl)-2,3,4,5,7,7a-hexahydrothiopyrano[2,3-c]pyrrol-6-yl]-(1H-pyrazol-5-yl)methanone.
| Compound Name | [(4aS,7aS)-1,1-dioxo-4a-(trifluoromethyl)-2,3,4,5,7,7a-hexahydrothiopyrano[2,3-c]pyrrol-6-yl]-(1H-pyrazol-5-yl)methanone |
|---|---|
| PubChem CID | 138022307 |
| Molecular Formula | C12H14F3N3O3S |
| Molecular Weight | 337.32 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | [(4aS,7aS)-1,1-dioxo-4a-(trifluoromethyl)-2,3,4,5,7,7a-hexahydrothiopyrano[2,3-c]pyrrol-6-yl]-(1H-pyrazol-5-yl)methanone |
| SMILES | O=C(c1ccn[nH]1)N1C[C@@H]2[C@@](C(F)(F)F)(CCCS2(=O)=O)C1 |
| InChI | InChI=1S/C12H14F3N3O3S/c13-12(14,15)11-3-1-5-22(20,21)9(11)6-18(7-11)10(19)8-2-4-16-17-8/h2,4,9H,1,3,5-7H2,(H,16,17)/t9-,11-/m1/s1 |
| InChIKey | VHVFVGDIXXPFKO-MWLCHTKSSA-N |
| XLogP | 0.99 |
| TPSA | 83.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.32 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |