C13H16F3N3O3 — CID 138022504
3-methoxy-N-[(2-methoxy-4-pyridinyl)methyl]-3-(trifluoromethyl)azetidine-1-carboxamide (PubChem CID 138022504) has the molecular formula C13H16F3N3O3 and a molecular weight of 319.28 g/mol. Its IUPAC name is 3-methoxy-N-[(2-methoxy-4-pyridinyl)methyl]-3-(trifluoromethyl)azetidine-1-carboxamide.
| Compound Name | 3-methoxy-N-[(2-methoxy-4-pyridinyl)methyl]-3-(trifluoromethyl)azetidine-1-carboxamide |
|---|---|
| PubChem CID | 138022504 |
| Molecular Formula | C13H16F3N3O3 |
| Molecular Weight | 319.28 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 3-methoxy-N-[(2-methoxy-4-pyridinyl)methyl]-3-(trifluoromethyl)azetidine-1-carboxamide |
| SMILES | COc1cc(CNC(=O)N2CC(OC)(C(F)(F)F)C2)ccn1 |
| InChI | InChI=1S/C13H16F3N3O3/c1-21-10-5-9(3-4-17-10)6-18-11(20)19-7-12(8-19,22-2)13(14,15)16/h3-5H,6-8H2,1-2H3,(H,18,20) |
| InChIKey | VRIHBRMPBWLTBH-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.28 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |