C18H19NO4 — CID 138026649
N-[(2-hydroxy-5-methoxyphenyl)methyl]-3,4-dihydro-1H-isochromene-5-carboxamide (PubChem CID 138026649) has the molecular formula C18H19NO4 and a molecular weight of 313.35 g/mol. Its IUPAC name is N-[(2-hydroxy-5-methoxyphenyl)methyl]-3,4-dihydro-1H-isochromene-5-carboxamide.
| Compound Name | N-[(2-hydroxy-5-methoxyphenyl)methyl]-3,4-dihydro-1H-isochromene-5-carboxamide |
|---|---|
| PubChem CID | 138026649 |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | N-[(2-hydroxy-5-methoxyphenyl)methyl]-3,4-dihydro-1H-isochromene-5-carboxamide |
| SMILES | COc1ccc(O)c(CNC(=O)c2cccc3c2CCOC3)c1 |
| InChI | InChI=1S/C18H19NO4/c1-22-14-5-6-17(20)13(9-14)10-19-18(21)16-4-2-3-12-11-23-8-7-15(12)16/h2-6,9,20H,7-8,10-11H2,1H3,(H,19,21) |
| InChIKey | KCFPVIAQIWGOFS-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|