C30H30N4O6 — CID 44621400
N'-[(2-hydroxy-5-methoxyphenyl)methyl]-4-[4-[[(2-hydroxy-5-methoxyphenyl)methylamino]carbamoyl]phenyl]benzohydrazide (PubChem CID 44621400) has the molecular formula C30H30N4O6 and a molecular weight of 542.59 g/mol. Its IUPAC name is N'-[(2-hydroxy-5-methoxyphenyl)methyl]-4-[4-[[(2-hydroxy-5-methoxyphenyl)methylamino]carbamoyl]phenyl]benzohydrazide.
| Compound Name | N'-[(2-hydroxy-5-methoxyphenyl)methyl]-4-[4-[[(2-hydroxy-5-methoxyphenyl)methylamino]carbamoyl]phenyl]benzohydrazide |
|---|---|
| PubChem CID | 44621400 |
| Molecular Formula | C30H30N4O6 |
| Molecular Weight | 542.59 g/mol |
| Exact Mass | 542.22 |
| IUPAC Name | N'-[(2-hydroxy-5-methoxyphenyl)methyl]-4-[4-[[(2-hydroxy-5-methoxyphenyl)methylamino]carbamoyl]phenyl]benzohydrazide |
| SMILES | COc1ccc(O)c(CNNC(=O)c2ccc(-c3ccc(C(=O)NNCc4cc(OC)ccc4O)cc3)cc2)c1 |
| InChI | InChI=1S/C30H30N4O6/c1-39-25-11-13-27(35)23(15-25)17-31-33-29(37)21-7-3-19(4-8-21)20-5-9-22(10-6-20)30(38)34-32-18-24-16-26(40-2)12-14-28(24)36/h3-16,31-32,35-36H,17-18H2,1-2H3,(H,33,37)(H,34,38) |
| InChIKey | YVMMDQCLLHTYRQ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 141.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.59 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|