C18H21N3O3S — CID 138029068
4-[[4-(dimethylamino)quinoline-2-carbonyl]amino]thiane-4-carboxylic acid (PubChem CID 138029068) has the molecular formula C18H21N3O3S and a molecular weight of 359.45 g/mol. Its IUPAC name is 4-[[4-(dimethylamino)quinoline-2-carbonyl]amino]thiane-4-carboxylic acid.
| Compound Name | 4-[[4-(dimethylamino)quinoline-2-carbonyl]amino]thiane-4-carboxylic acid |
|---|---|
| PubChem CID | 138029068 |
| Molecular Formula | C18H21N3O3S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 4-[[4-(dimethylamino)quinoline-2-carbonyl]amino]thiane-4-carboxylic acid |
| SMILES | CN(C)c1cc(C(=O)NC2(C(=O)O)CCSCC2)nc2ccccc12 |
| InChI | InChI=1S/C18H21N3O3S/c1-21(2)15-11-14(19-13-6-4-3-5-12(13)15)16(22)20-18(17(23)24)7-9-25-10-8-18/h3-6,11H,7-10H2,1-2H3,(H,20,22)(H,23,24) |
| InChIKey | XAOHLTVSELDUPH-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |