C16H15ClN2O3S — CID 120531087
4-[(7-chloroquinoline-2-carbonyl)amino]thiane-4-carboxylic acid (PubChem CID 120531087) has the molecular formula C16H15ClN2O3S and a molecular weight of 350.83 g/mol. Its IUPAC name is 4-[(7-chloroquinoline-2-carbonyl)amino]thiane-4-carboxylic acid.
| Compound Name | 4-[(7-chloroquinoline-2-carbonyl)amino]thiane-4-carboxylic acid |
|---|---|
| PubChem CID | 120531087 |
| Molecular Formula | C16H15ClN2O3S |
| Molecular Weight | 350.83 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | 4-[(7-chloroquinoline-2-carbonyl)amino]thiane-4-carboxylic acid |
| SMILES | O=C(NC1(C(=O)O)CCSCC1)c1ccc2ccc(Cl)cc2n1 |
| InChI | InChI=1S/C16H15ClN2O3S/c17-11-3-1-10-2-4-12(18-13(10)9-11)14(20)19-16(15(21)22)5-7-23-8-6-16/h1-4,9H,5-8H2,(H,19,20)(H,21,22) |
| InChIKey | LEDPSJCNSKOLIY-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.83 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |