C15H14ClNO4S — CID 125148475
(3R)-3-[(6-chloro-2H-chromene-3-carbonyl)amino]thiolane-3-carboxylic acid (PubChem CID 125148475) has the molecular formula C15H14ClNO4S and a molecular weight of 339.80 g/mol. Its IUPAC name is (3R)-3-[(6-chloro-2H-chromene-3-carbonyl)amino]thiolane-3-carboxylic acid.
| Compound Name | (3R)-3-[(6-chloro-2H-chromene-3-carbonyl)amino]thiolane-3-carboxylic acid |
|---|---|
| PubChem CID | 125148475 |
| Molecular Formula | C15H14ClNO4S |
| Molecular Weight | 339.80 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | (3R)-3-[(6-chloro-2H-chromene-3-carbonyl)amino]thiolane-3-carboxylic acid |
| SMILES | O=C(N[C@@]1(C(=O)O)CCSC1)C1=Cc2cc(Cl)ccc2OC1 |
| InChI | InChI=1S/C15H14ClNO4S/c16-11-1-2-12-9(6-11)5-10(7-21-12)13(18)17-15(14(19)20)3-4-22-8-15/h1-2,5-6H,3-4,7-8H2,(H,17,18)(H,19,20)/t15-/m0/s1 |
| InChIKey | KKDJTYDTQIXLTQ-HNNXBMFYSA-N |
| XLogP | 2.19 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.80 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |