About 8-(2,3-dihydro-1H-indene-2-carbonylamino)-5-oxaspiro[3.5]nonane-2-carboxylic acid
8-(2,3-dihydro-1H-indene-2-carbonylamino)-5-oxaspiro[3.5]nonane-2-carboxylic acid (PubChem CID 138029372) has the molecular formula C19H23NO4
and a molecular weight of 329.40 g/mol. Its IUPAC name is 8-(2,3-dihydro-1H-indene-2-carbonylamino)-5-oxaspiro[3.5]nonane-2-carboxylic acid.
Molecular Properties
| Compound Name | 8-(2,3-dihydro-1H-indene-2-carbonylamino)-5-oxaspiro[3.5]nonane-2-carboxylic acid |
| PubChem CID | 138029372 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 8-(2,3-dihydro-1H-indene-2-carbonylamino)-5-oxaspiro[3.5]nonane-2-carboxylic acid |
| SMILES | O=C(O)C1CC2(CC(NC(=O)C3Cc4ccccc4C3)CCO2)C1 |
| InChI | InChI=1S/C19H23NO4/c21-17(14-7-12-3-1-2-4-13(12)8-14)20-16-5-6-24-19(11-16)9-15(10-19)18(22)23/h1-4,14-16H,5-11H2,(H,20,21)(H,22,23) |
| InChIKey | QIMKORGUUPEHQD-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-(2,3-dihydro-1H-indene-2-carbonylamino)-5-oxaspiro[3.5]nonane-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(2,3-dihydro-1H-indene-2-carbonylamino)-5-oxaspiro[3.5]nonane-2-carboxylic acid?
The IUPAC name of 8-(2,3-dihydro-1H-indene-2-carbonylamino)-5-oxaspiro[3.5]nonane-2-carboxylic acid (CID 138029372) is 8-(2,3-dihydro-1H-indene-2-carbonylamino)-5-oxaspiro[3.5]nonane-2-carboxylic acid.
What is the SMILES notation for 8-(2,3-dihydro-1H-indene-2-carbonylamino)-5-oxaspiro[3.5]nonane-2-carboxylic acid?
The canonical SMILES for 8-(2,3-dihydro-1H-indene-2-carbonylamino)-5-oxaspiro[3.5]nonane-2-carboxylic acid is O=C(O)C1CC2(CC(NC(=O)C3Cc4ccccc4C3)CCO2)C1.
What is the InChIKey of 8-(2,3-dihydro-1H-indene-2-carbonylamino)-5-oxaspiro[3.5]nonane-2-carboxylic acid?
The InChIKey is QIMKORGUUPEHQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23NO4/c21-17(14-7-12-3-1-2-4-13(12)8-14)20-16-5-6-24-19(11-16)9-15(10-19)18(22)23/h1-4,14-16H,5-11H2,(H,20,21)(H,22,23).
What are the key properties of 8-(2,3-dihydro-1H-indene-2-carbonylamino)-5-oxaspiro[3.5]nonane-2-carboxylic acid?
8-(2,3-dihydro-1H-indene-2-carbonylamino)-5-oxaspiro[3.5]nonane-2-carboxylic acid has a molecular weight of 329.40 g/mol, XLogP of 1.93, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(2,3-dihydro-1H-indene-2-carbonylamino)-5-oxaspiro[3.5]nonane-2-carboxylic acid is sourced from PubChem (CID 138029372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).