About 1-[1-(3-methyltriazolo[4,5-b]pyridine-7-carbonyl)piperidin-4-yl]pyrazole-4-carboxylic acid
1-[1-(3-methyltriazolo[4,5-b]pyridine-7-carbonyl)piperidin-4-yl]pyrazole-4-carboxylic acid (PubChem CID 138038167) has the molecular formula C16H17N7O3
and a molecular weight of 355.36 g/mol. Its IUPAC name is 1-[1-(3-methyltriazolo[4,5-b]pyridine-7-carbonyl)piperidin-4-yl]pyrazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 1-[1-(3-methyltriazolo[4,5-b]pyridine-7-carbonyl)piperidin-4-yl]pyrazole-4-carboxylic acid |
| PubChem CID | 138038167 |
| Molecular Formula | C16H17N7O3 |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 1-[1-(3-methyltriazolo[4,5-b]pyridine-7-carbonyl)piperidin-4-yl]pyrazole-4-carboxylic acid |
| SMILES | Cn1nnc2c(C(=O)N3CCC(n4cc(C(=O)O)cn4)CC3)ccnc21 |
| InChI | InChI=1S/C16H17N7O3/c1-21-14-13(19-20-21)12(2-5-17-14)15(24)22-6-3-11(4-7-22)23-9-10(8-18-23)16(25)26/h2,5,8-9,11H,3-4,6-7H2,1H3,(H,25,26) |
| InChIKey | MAFYJGSSWZAPFK-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 119.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 1-[1-(3-methyltriazolo[4,5-b]pyridine-7-carbonyl)piperidin-4-yl]pyrazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(3-methyltriazolo[4,5-b]pyridine-7-carbonyl)piperidin-4-yl]pyrazole-4-carboxylic acid?
The IUPAC name of 1-[1-(3-methyltriazolo[4,5-b]pyridine-7-carbonyl)piperidin-4-yl]pyrazole-4-carboxylic acid (CID 138038167) is 1-[1-(3-methyltriazolo[4,5-b]pyridine-7-carbonyl)piperidin-4-yl]pyrazole-4-carboxylic acid.
What is the SMILES notation for 1-[1-(3-methyltriazolo[4,5-b]pyridine-7-carbonyl)piperidin-4-yl]pyrazole-4-carboxylic acid?
The canonical SMILES for 1-[1-(3-methyltriazolo[4,5-b]pyridine-7-carbonyl)piperidin-4-yl]pyrazole-4-carboxylic acid is Cn1nnc2c(C(=O)N3CCC(n4cc(C(=O)O)cn4)CC3)ccnc21.
What is the InChIKey of 1-[1-(3-methyltriazolo[4,5-b]pyridine-7-carbonyl)piperidin-4-yl]pyrazole-4-carboxylic acid?
The InChIKey is MAFYJGSSWZAPFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N7O3/c1-21-14-13(19-20-21)12(2-5-17-14)15(24)22-6-3-11(4-7-22)23-9-10(8-18-23)16(25)26/h2,5,8-9,11H,3-4,6-7H2,1H3,(H,25,26).
What are the key properties of 1-[1-(3-methyltriazolo[4,5-b]pyridine-7-carbonyl)piperidin-4-yl]pyrazole-4-carboxylic acid?
1-[1-(3-methyltriazolo[4,5-b]pyridine-7-carbonyl)piperidin-4-yl]pyrazole-4-carboxylic acid has a molecular weight of 355.36 g/mol, XLogP of 0.74, 3 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(3-methyltriazolo[4,5-b]pyridine-7-carbonyl)piperidin-4-yl]pyrazole-4-carboxylic acid is sourced from PubChem (CID 138038167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).