C12H18F3N3O3S — CID 138041152
1-(1,5-dimethylpyrazol-4-yl)sulfonyl-4-(trifluoromethyl)azepan-4-ol (PubChem CID 138041152) has the molecular formula C12H18F3N3O3S and a molecular weight of 341.36 g/mol. Its IUPAC name is 1-(1,5-dimethylpyrazol-4-yl)sulfonyl-4-(trifluoromethyl)azepan-4-ol.
| Compound Name | 1-(1,5-dimethylpyrazol-4-yl)sulfonyl-4-(trifluoromethyl)azepan-4-ol |
|---|---|
| PubChem CID | 138041152 |
| Molecular Formula | C12H18F3N3O3S |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 1-(1,5-dimethylpyrazol-4-yl)sulfonyl-4-(trifluoromethyl)azepan-4-ol |
| SMILES | Cc1c(S(=O)(=O)N2CCCC(O)(C(F)(F)F)CC2)cnn1C |
| InChI | InChI=1S/C12H18F3N3O3S/c1-9-10(8-16-17(9)2)22(20,21)18-6-3-4-11(19,5-7-18)12(13,14)15/h8,19H,3-7H2,1-2H3 |
| InChIKey | UEBQNQXGZYTQLY-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |