C13H9BrFNO4 — CID 138042550
2-[(5-bromofuran-2-carbonyl)amino]-2-(2-fluorophenyl)acetic acid (PubChem CID 138042550) has the molecular formula C13H9BrFNO4 and a molecular weight of 342.12 g/mol. Its IUPAC name is 2-[(5-bromofuran-2-carbonyl)amino]-2-(2-fluorophenyl)acetic acid.
| Compound Name | 2-[(5-bromofuran-2-carbonyl)amino]-2-(2-fluorophenyl)acetic acid |
|---|---|
| PubChem CID | 138042550 |
| Molecular Formula | C13H9BrFNO4 |
| Molecular Weight | 342.12 g/mol |
| Exact Mass | 340.97 |
| IUPAC Name | 2-[(5-bromofuran-2-carbonyl)amino]-2-(2-fluorophenyl)acetic acid |
| SMILES | O=C(NC(C(=O)O)c1ccccc1F)c1ccc(Br)o1 |
| InChI | InChI=1S/C13H9BrFNO4/c14-10-6-5-9(20-10)12(17)16-11(13(18)19)7-3-1-2-4-8(7)15/h1-6,11H,(H,16,17)(H,18,19) |
| InChIKey | UFZLUHKTVARWFY-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.12 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |