C13H14N4O3S — CID 138049585
1-methylsulfonyl-N-(1-phenyltriazol-4-yl)cyclopropane-1-carboxamide (PubChem CID 138049585) has the molecular formula C13H14N4O3S and a molecular weight of 306.35 g/mol. Its IUPAC name is 1-methylsulfonyl-N-(1-phenyltriazol-4-yl)cyclopropane-1-carboxamide.
| Compound Name | 1-methylsulfonyl-N-(1-phenyltriazol-4-yl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 138049585 |
| Molecular Formula | C13H14N4O3S |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 1-methylsulfonyl-N-(1-phenyltriazol-4-yl)cyclopropane-1-carboxamide |
| SMILES | CS(=O)(=O)C1(C(=O)Nc2cn(-c3ccccc3)nn2)CC1 |
| InChI | InChI=1S/C13H14N4O3S/c1-21(19,20)13(7-8-13)12(18)14-11-9-17(16-15-11)10-5-3-2-4-6-10/h2-6,9H,7-8H2,1H3,(H,14,18) |
| InChIKey | TXDPLGINMFLSQV-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |