C23H18N6O2 — CID 167786859
1-[4-(5-methyl-1,3-benzoxazol-2-yl)phenyl]-3-(1-phenyltriazol-4-yl)urea (PubChem CID 167786859) has the molecular formula C23H18N6O2 and a molecular weight of 410.44 g/mol. Its IUPAC name is 1-[4-(5-methyl-1,3-benzoxazol-2-yl)phenyl]-3-(1-phenyltriazol-4-yl)urea.
| Compound Name | 1-[4-(5-methyl-1,3-benzoxazol-2-yl)phenyl]-3-(1-phenyltriazol-4-yl)urea |
|---|---|
| PubChem CID | 167786859 |
| Molecular Formula | C23H18N6O2 |
| Molecular Weight | 410.44 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 1-[4-(5-methyl-1,3-benzoxazol-2-yl)phenyl]-3-(1-phenyltriazol-4-yl)urea |
| SMILES | Cc1ccc2oc(-c3ccc(NC(=O)Nc4cn(-c5ccccc5)nn4)cc3)nc2c1 |
| InChI | InChI=1S/C23H18N6O2/c1-15-7-12-20-19(13-15)25-22(31-20)16-8-10-17(11-9-16)24-23(30)26-21-14-29(28-27-21)18-5-3-2-4-6-18/h2-14H,1H3,(H2,24,26,30) |
| InChIKey | NQXDHNCDCFFEBK-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 97.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.44 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |