About N-(4-benzo[f][1,3]benzoxazol-2-ylphenyl)-2-(4-methylphenyl)sulfanylacetamide
N-(4-benzo[f][1,3]benzoxazol-2-ylphenyl)-2-(4-methylphenyl)sulfanylacetamide (PubChem CID 17296581) has the molecular formula C26H20N2O2S
and a molecular weight of 424.53 g/mol. Its IUPAC name is N-(4-benzo[f][1,3]benzoxazol-2-ylphenyl)-2-(4-methylphenyl)sulfanylacetamide.
Molecular Properties
| Compound Name | N-(4-benzo[f][1,3]benzoxazol-2-ylphenyl)-2-(4-methylphenyl)sulfanylacetamide |
| PubChem CID | 17296581 |
| Molecular Formula | C26H20N2O2S |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | N-(4-benzo[f][1,3]benzoxazol-2-ylphenyl)-2-(4-methylphenyl)sulfanylacetamide |
| SMILES | Cc1ccc(SCC(=O)Nc2ccc(-c3nc4cc5ccccc5cc4o3)cc2)cc1 |
| InChI | InChI=1S/C26H20N2O2S/c1-17-6-12-22(13-7-17)31-16-25(29)27-21-10-8-18(9-11-21)26-28-23-14-19-4-2-3-5-20(19)15-24(23)30-26/h2-15H,16H2,1H3,(H,27,29) |
| InChIKey | GTURSMCTEPMGCV-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(4-benzo[f][1,3]benzoxazol-2-ylphenyl)-2-(4-methylphenyl)sulfanylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-benzo[f][1,3]benzoxazol-2-ylphenyl)-2-(4-methylphenyl)sulfanylacetamide?
The IUPAC name of N-(4-benzo[f][1,3]benzoxazol-2-ylphenyl)-2-(4-methylphenyl)sulfanylacetamide (CID 17296581) is N-(4-benzo[f][1,3]benzoxazol-2-ylphenyl)-2-(4-methylphenyl)sulfanylacetamide.
What is the SMILES notation for N-(4-benzo[f][1,3]benzoxazol-2-ylphenyl)-2-(4-methylphenyl)sulfanylacetamide?
The canonical SMILES for N-(4-benzo[f][1,3]benzoxazol-2-ylphenyl)-2-(4-methylphenyl)sulfanylacetamide is Cc1ccc(SCC(=O)Nc2ccc(-c3nc4cc5ccccc5cc4o3)cc2)cc1.
What is the InChIKey of N-(4-benzo[f][1,3]benzoxazol-2-ylphenyl)-2-(4-methylphenyl)sulfanylacetamide?
The InChIKey is GTURSMCTEPMGCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H20N2O2S/c1-17-6-12-22(13-7-17)31-16-25(29)27-21-10-8-18(9-11-21)26-28-23-14-19-4-2-3-5-20(19)15-24(23)30-26/h2-15H,16H2,1H3,(H,27,29).
What are the key properties of N-(4-benzo[f][1,3]benzoxazol-2-ylphenyl)-2-(4-methylphenyl)sulfanylacetamide?
N-(4-benzo[f][1,3]benzoxazol-2-ylphenyl)-2-(4-methylphenyl)sulfanylacetamide has a molecular weight of 424.53 g/mol, XLogP of 6.69, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-benzo[f][1,3]benzoxazol-2-ylphenyl)-2-(4-methylphenyl)sulfanylacetamide is sourced from PubChem (CID 17296581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).