C18H21N3 — CID 138050000
N-benzyl-5-(1-phenylethyl)-4,5-dihydro-1H-imidazol-2-amine (PubChem CID 138050000) has the molecular formula C18H21N3 and a molecular weight of 279.39 g/mol. Its IUPAC name is N-benzyl-5-(1-phenylethyl)-4,5-dihydro-1H-imidazol-2-amine.
| Compound Name | N-benzyl-5-(1-phenylethyl)-4,5-dihydro-1H-imidazol-2-amine |
|---|---|
| PubChem CID | 138050000 |
| Molecular Formula | C18H21N3 |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | N-benzyl-5-(1-phenylethyl)-4,5-dihydro-1H-imidazol-2-amine |
| SMILES | CC(c1ccccc1)C1CN=C(NCc2ccccc2)N1 |
| InChI | InChI=1S/C18H21N3/c1-14(16-10-6-3-7-11-16)17-13-20-18(21-17)19-12-15-8-4-2-5-9-15/h2-11,14,17H,12-13H2,1H3,(H2,19,20,21) |
| InChIKey | RUEFXRJFISOPHI-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |