C12H17N3 — CID 154782801
N-benzyl-5-methyl-1,4,5,6-tetrahydropyrimidin-2-amine (PubChem CID 154782801) has the molecular formula C12H17N3 and a molecular weight of 203.29 g/mol. Its IUPAC name is N-benzyl-5-methyl-1,4,5,6-tetrahydropyrimidin-2-amine.
| Compound Name | N-benzyl-5-methyl-1,4,5,6-tetrahydropyrimidin-2-amine |
|---|---|
| PubChem CID | 154782801 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | N-benzyl-5-methyl-1,4,5,6-tetrahydropyrimidin-2-amine |
| SMILES | CC1CN=C(NCc2ccccc2)NC1 |
| InChI | InChI=1S/C12H17N3/c1-10-7-13-12(14-8-10)15-9-11-5-3-2-4-6-11/h2-6,10H,7-9H2,1H3,(H2,13,14,15) |
| InChIKey | NYJLWFIDQMWURP-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |