About 4-thieno[3,2-d]pyrimidin-4-yl-1-oxa-9λ6-thia-4-azaspiro[5.5]undecane 9,9-dioxide
4-thieno[3,2-d]pyrimidin-4-yl-1-oxa-9λ6-thia-4-azaspiro[5.5]undecane 9,9-dioxide (PubChem CID 138050750) has the molecular formula C14H17N3O3S2
and a molecular weight of 339.44 g/mol. Its IUPAC name is 4-thieno[3,2-d]pyrimidin-4-yl-1-oxa-9λ6-thia-4-azaspiro[5.5]undecane 9,9-dioxide.
Molecular Properties
| Compound Name | 4-thieno[3,2-d]pyrimidin-4-yl-1-oxa-9λ6-thia-4-azaspiro[5.5]undecane 9,9-dioxide |
| PubChem CID | 138050750 |
| Molecular Formula | C14H17N3O3S2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | 4-thieno[3,2-d]pyrimidin-4-yl-1-oxa-9λ6-thia-4-azaspiro[5.5]undecane 9,9-dioxide |
| SMILES | O=S1(=O)CCC2(CC1)CN(c1ncnc3ccsc13)CCO2 |
| InChI | InChI=1S/C14H17N3O3S2/c18-22(19)7-2-14(3-8-22)9-17(4-5-20-14)13-12-11(1-6-21-12)15-10-16-13/h1,6,10H,2-5,7-9H2 |
| InChIKey | HDEMCBDAFDFIPH-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-thieno[3,2-d]pyrimidin-4-yl-1-oxa-9λ6-thia-4-azaspiro[5.5]undecane 9,9-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-thieno[3,2-d]pyrimidin-4-yl-1-oxa-9λ6-thia-4-azaspiro[5.5]undecane 9,9-dioxide?
The IUPAC name of 4-thieno[3,2-d]pyrimidin-4-yl-1-oxa-9λ6-thia-4-azaspiro[5.5]undecane 9,9-dioxide (CID 138050750) is 4-thieno[3,2-d]pyrimidin-4-yl-1-oxa-9λ6-thia-4-azaspiro[5.5]undecane 9,9-dioxide.
What is the SMILES notation for 4-thieno[3,2-d]pyrimidin-4-yl-1-oxa-9λ6-thia-4-azaspiro[5.5]undecane 9,9-dioxide?
The canonical SMILES for 4-thieno[3,2-d]pyrimidin-4-yl-1-oxa-9λ6-thia-4-azaspiro[5.5]undecane 9,9-dioxide is O=S1(=O)CCC2(CC1)CN(c1ncnc3ccsc13)CCO2.
What is the InChIKey of 4-thieno[3,2-d]pyrimidin-4-yl-1-oxa-9λ6-thia-4-azaspiro[5.5]undecane 9,9-dioxide?
The InChIKey is HDEMCBDAFDFIPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3O3S2/c18-22(19)7-2-14(3-8-22)9-17(4-5-20-14)13-12-11(1-6-21-12)15-10-16-13/h1,6,10H,2-5,7-9H2.
What are the key properties of 4-thieno[3,2-d]pyrimidin-4-yl-1-oxa-9λ6-thia-4-azaspiro[5.5]undecane 9,9-dioxide?
4-thieno[3,2-d]pyrimidin-4-yl-1-oxa-9λ6-thia-4-azaspiro[5.5]undecane 9,9-dioxide has a molecular weight of 339.44 g/mol, XLogP of 1.48, 1 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-thieno[3,2-d]pyrimidin-4-yl-1-oxa-9λ6-thia-4-azaspiro[5.5]undecane 9,9-dioxide is sourced from PubChem (CID 138050750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).