C15H19N3OS — CID 163343509
(2-thieno[3,2-d]pyrimidin-4-yl-3,4,5,6,7,7a-hexahydro-1H-isoindol-3a-yl)methanol (PubChem CID 163343509) has the molecular formula C15H19N3OS and a molecular weight of 289.40 g/mol. Its IUPAC name is (2-thieno[3,2-d]pyrimidin-4-yl-3,4,5,6,7,7a-hexahydro-1H-isoindol-3a-yl)methanol.
| Compound Name | (2-thieno[3,2-d]pyrimidin-4-yl-3,4,5,6,7,7a-hexahydro-1H-isoindol-3a-yl)methanol |
|---|---|
| PubChem CID | 163343509 |
| Molecular Formula | C15H19N3OS |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | (2-thieno[3,2-d]pyrimidin-4-yl-3,4,5,6,7,7a-hexahydro-1H-isoindol-3a-yl)methanol |
| SMILES | OCC12CCCCC1CN(c1ncnc3ccsc13)C2 |
| InChI | InChI=1S/C15H19N3OS/c19-9-15-5-2-1-3-11(15)7-18(8-15)14-13-12(4-6-20-13)16-10-17-14/h4,6,10-11,19H,1-3,5,7-9H2 |
| InChIKey | SQDCDMDKZHWMBM-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |