C14H21N5O2 — CID 138051692
1-[(4-cyclopropyl-5-oxo-1H-1,2,4-triazol-3-yl)methyl]-3-[(1R,6R)-6-methylcyclohex-3-en-1-yl]urea (PubChem CID 138051692) has the molecular formula C14H21N5O2 and a molecular weight of 291.35 g/mol. Its IUPAC name is 1-[(4-cyclopropyl-5-oxo-1H-1,2,4-triazol-3-yl)methyl]-3-[(1R,6R)-6-methylcyclohex-3-en-1-yl]urea.
| Compound Name | 1-[(4-cyclopropyl-5-oxo-1H-1,2,4-triazol-3-yl)methyl]-3-[(1R,6R)-6-methylcyclohex-3-en-1-yl]urea |
|---|---|
| PubChem CID | 138051692 |
| Molecular Formula | C14H21N5O2 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | 1-[(4-cyclopropyl-5-oxo-1H-1,2,4-triazol-3-yl)methyl]-3-[(1R,6R)-6-methylcyclohex-3-en-1-yl]urea |
| SMILES | C[C@@H]1CC=CC[C@H]1NC(=O)NCc1n[nH]c(=O)n1C1CC1 |
| InChI | InChI=1S/C14H21N5O2/c1-9-4-2-3-5-11(9)16-13(20)15-8-12-17-18-14(21)19(12)10-6-7-10/h2-3,9-11H,4-8H2,1H3,(H,18,21)(H2,15,16,20)/t9-,11-/m1/s1 |
| InChIKey | GNCCUDODHZNESB-MWLCHTKSSA-N |
| XLogP | 1.06 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|