C16H22FNO4S — CID 138057412
(3R,3aR,6aS)-5-[(3-ethoxy-5-fluorophenyl)methyl]-3-methoxy-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrole 1,1-dioxide (PubChem CID 138057412) has the molecular formula C16H22FNO4S and a molecular weight of 343.42 g/mol. Its IUPAC name is (3R,3aR,6aS)-5-[(3-ethoxy-5-fluorophenyl)methyl]-3-methoxy-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrole 1,1-dioxide.
| Compound Name | (3R,3aR,6aS)-5-[(3-ethoxy-5-fluorophenyl)methyl]-3-methoxy-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrole 1,1-dioxide |
|---|---|
| PubChem CID | 138057412 |
| Molecular Formula | C16H22FNO4S |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | (3R,3aR,6aS)-5-[(3-ethoxy-5-fluorophenyl)methyl]-3-methoxy-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrole 1,1-dioxide |
| SMILES | CCOc1cc(F)cc(CN2C[C@@H]3[C@@H](OC)CS(=O)(=O)[C@@H]3C2)c1 |
| InChI | InChI=1S/C16H22FNO4S/c1-3-22-13-5-11(4-12(17)6-13)7-18-8-14-15(21-2)10-23(19,20)16(14)9-18/h4-6,14-16H,3,7-10H2,1-2H3/t14-,15+,16-/m1/s1 |
| InChIKey | XPAKOVLTUQAFOW-OWCLPIDISA-N |
| XLogP | 1.47 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |