C16H21NO4S — CID 139020762
[(3R,3aR,6aS)-3-methoxy-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]-(4-ethylphenyl)methanone (PubChem CID 139020762) has the molecular formula C16H21NO4S and a molecular weight of 323.41 g/mol. Its IUPAC name is [(3R,3aR,6aS)-3-methoxy-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]-(4-ethylphenyl)methanone.
| Compound Name | [(3R,3aR,6aS)-3-methoxy-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]-(4-ethylphenyl)methanone |
|---|---|
| PubChem CID | 139020762 |
| Molecular Formula | C16H21NO4S |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | [(3R,3aR,6aS)-3-methoxy-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]-(4-ethylphenyl)methanone |
| SMILES | CCc1ccc(C(=O)N2C[C@@H]3[C@@H](OC)CS(=O)(=O)[C@@H]3C2)cc1 |
| InChI | InChI=1S/C16H21NO4S/c1-3-11-4-6-12(7-5-11)16(18)17-8-13-14(21-2)10-22(19,20)15(13)9-17/h4-7,13-15H,3,8-10H2,1-2H3/t13-,14+,15-/m1/s1 |
| InChIKey | BIXVOMLOLKWFCC-QLFBSQMISA-N |
| XLogP | 1.13 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |