C18H24N2O3 — CID 97362617
(3aR,7S,7aR)-2-(4-ethylbenzoyl)-N-methyl-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole-7-carboxamide (PubChem CID 97362617) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is (3aR,7S,7aR)-2-(4-ethylbenzoyl)-N-methyl-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole-7-carboxamide.
| Compound Name | (3aR,7S,7aR)-2-(4-ethylbenzoyl)-N-methyl-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole-7-carboxamide |
|---|---|
| PubChem CID | 97362617 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | (3aR,7S,7aR)-2-(4-ethylbenzoyl)-N-methyl-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole-7-carboxamide |
| SMILES | CCc1ccc(C(=O)N2C[C@@H]3COC[C@@H](C(=O)NC)[C@@H]3C2)cc1 |
| InChI | InChI=1S/C18H24N2O3/c1-3-12-4-6-13(7-5-12)18(22)20-8-14-10-23-11-16(15(14)9-20)17(21)19-2/h4-7,14-16H,3,8-11H2,1-2H3,(H,19,21)/t14-,15-,16-/m1/s1 |
| InChIKey | UIRXCRDXTWRDLJ-BZUAXINKSA-N |
| XLogP | 1.33 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |