C24H27N3O2 — CID 138058230
[3-(1H-indol-3-ylmethyl)morpholin-4-yl]-(3-pyrrolidin-1-ylphenyl)methanone (PubChem CID 138058230) has the molecular formula C24H27N3O2 and a molecular weight of 389.50 g/mol. Its IUPAC name is [3-(1H-indol-3-ylmethyl)morpholin-4-yl]-(3-pyrrolidin-1-ylphenyl)methanone.
| Compound Name | [3-(1H-indol-3-ylmethyl)morpholin-4-yl]-(3-pyrrolidin-1-ylphenyl)methanone |
|---|---|
| PubChem CID | 138058230 |
| Molecular Formula | C24H27N3O2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | [3-(1H-indol-3-ylmethyl)morpholin-4-yl]-(3-pyrrolidin-1-ylphenyl)methanone |
| SMILES | O=C(c1cccc(N2CCCC2)c1)N1CCOCC1Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C24H27N3O2/c28-24(18-6-5-7-20(14-18)26-10-3-4-11-26)27-12-13-29-17-21(27)15-19-16-25-23-9-2-1-8-22(19)23/h1-2,5-9,14,16,21,25H,3-4,10-13,15,17H2 |
| InChIKey | DAIFNQMFFKHZPN-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |