C31H41N5O3 — CID 87940159
(3,5-dimethylphenyl)-[(2R)-2-(1H-indol-3-ylmethyl)-4-[(2E)-2-(2-morpholin-4-ylethoxyimino)propyl]piperazin-1-yl]methanone (PubChem CID 87940159) has the molecular formula C31H41N5O3 and a molecular weight of 531.70 g/mol. Its IUPAC name is (3,5-dimethylphenyl)-[(2R)-2-(1H-indol-3-ylmethyl)-4-[(2E)-2-(2-morpholin-4-ylethoxyimino)propyl]piperazin-1-yl]methanone.
| Compound Name | (3,5-dimethylphenyl)-[(2R)-2-(1H-indol-3-ylmethyl)-4-[(2E)-2-(2-morpholin-4-ylethoxyimino)propyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 87940159 |
| Molecular Formula | C31H41N5O3 |
| Molecular Weight | 531.70 g/mol |
| Exact Mass | 531.32 |
| IUPAC Name | (3,5-dimethylphenyl)-[(2R)-2-(1H-indol-3-ylmethyl)-4-[(2E)-2-(2-morpholin-4-ylethoxyimino)propyl]piperazin-1-yl]methanone |
| SMILES | C/C(CN1CCN(C(=O)c2cc(C)cc(C)c2)[C@H](Cc2c[nH]c3ccccc23)C1)=N\OCCN1CCOCC1 |
| InChI | InChI=1S/C31H41N5O3/c1-23-16-24(2)18-26(17-23)31(37)36-9-8-35(21-25(3)33-39-15-12-34-10-13-38-14-11-34)22-28(36)19-27-20-32-30-7-5-4-6-29(27)30/h4-7,16-18,20,28,32H,8-15,19,21-22H2,1-3H3/b33-25+/t28-/m1/s1 |
| InChIKey | JBPMBOHWQCSFLS-LPPMAOQRSA-N |
| XLogP | 3.88 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.70 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|