C29H35F2N5O3 — CID 87940120
(3,5-difluorophenyl)-[(2R)-2-(1H-indol-3-ylmethyl)-4-[(2E)-2-(2-morpholin-4-ylethoxyimino)propyl]piperazin-1-yl]methanone (PubChem CID 87940120) has the molecular formula C29H35F2N5O3 and a molecular weight of 539.63 g/mol. Its IUPAC name is (3,5-difluorophenyl)-[(2R)-2-(1H-indol-3-ylmethyl)-4-[(2E)-2-(2-morpholin-4-ylethoxyimino)propyl]piperazin-1-yl]methanone.
| Compound Name | (3,5-difluorophenyl)-[(2R)-2-(1H-indol-3-ylmethyl)-4-[(2E)-2-(2-morpholin-4-ylethoxyimino)propyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 87940120 |
| Molecular Formula | C29H35F2N5O3 |
| Molecular Weight | 539.63 g/mol |
| Exact Mass | 539.27 |
| IUPAC Name | (3,5-difluorophenyl)-[(2R)-2-(1H-indol-3-ylmethyl)-4-[(2E)-2-(2-morpholin-4-ylethoxyimino)propyl]piperazin-1-yl]methanone |
| SMILES | C/C(CN1CCN(C(=O)c2cc(F)cc(F)c2)[C@H](Cc2c[nH]c3ccccc23)C1)=N\OCCN1CCOCC1 |
| InChI | InChI=1S/C29H35F2N5O3/c1-21(33-39-13-10-34-8-11-38-12-9-34)19-35-6-7-36(29(37)22-14-24(30)17-25(31)15-22)26(20-35)16-23-18-32-28-5-3-2-4-27(23)28/h2-5,14-15,17-18,26,32H,6-13,16,19-20H2,1H3/b33-21+/t26-/m1/s1 |
| InChIKey | NUAYVFNIAQITBV-UMBPSLTKSA-N |
| XLogP | 3.54 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.63 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|