C7H14N4S2 — CID 138106415
4-amino-3-(tert-butylsulfanylmethyl)-1H-1,2,4-triazole-5-thione (PubChem CID 138106415) has the molecular formula C7H14N4S2 and a molecular weight of 218.35 g/mol. Its IUPAC name is 4-amino-3-(tert-butylsulfanylmethyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-amino-3-(tert-butylsulfanylmethyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 138106415 |
| Molecular Formula | C7H14N4S2 |
| Molecular Weight | 218.35 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | 4-amino-3-(tert-butylsulfanylmethyl)-1H-1,2,4-triazole-5-thione |
| SMILES | CC(C)(C)SCc1n[nH]c(=S)n1N |
| InChI | InChI=1S/C7H14N4S2/c1-7(2,3)13-4-5-9-10-6(12)11(5)8/h4,8H2,1-3H3,(H,10,12) |
| InChIKey | BRJGYOFQBKQCDU-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 59.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.35 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|