C7H14N4O4S — CID 102581158
4-amino-3-[(2S,3R,4R)-2,3,4,5-tetrahydroxypentyl]-1H-1,2,4-triazole-5-thione (PubChem CID 102581158) has the molecular formula C7H14N4O4S and a molecular weight of 250.28 g/mol. Its IUPAC name is 4-amino-3-[(2S,3R,4R)-2,3,4,5-tetrahydroxypentyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-amino-3-[(2S,3R,4R)-2,3,4,5-tetrahydroxypentyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 102581158 |
| Molecular Formula | C7H14N4O4S |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | 4-amino-3-[(2S,3R,4R)-2,3,4,5-tetrahydroxypentyl]-1H-1,2,4-triazole-5-thione |
| SMILES | Nn1c(C[C@H](O)[C@@H](O)[C@H](O)CO)n[nH]c1=S |
| InChI | InChI=1S/C7H14N4O4S/c8-11-5(9-10-7(11)16)1-3(13)6(15)4(14)2-12/h3-4,6,12-15H,1-2,8H2,(H,10,16)/t3-,4+,6+/m0/s1 |
| InChIKey | JDTODTBUPKDTCS-MRKVFDINSA-N |
| XLogP | -2.73 |
| TPSA | 140.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | -2.73 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|